C24H26N6OS — CID 71184833
(2S,3R)-3-[[2-(4-pyrrolidin-1-ylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 71184833) has the molecular formula C24H26N6OS and a molecular weight of 446.58 g/mol. Its IUPAC name is (2S,3R)-3-[[2-(4-pyrrolidin-1-ylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (2S,3R)-3-[[2-(4-pyrrolidin-1-ylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 71184833 |
| Molecular Formula | C24H26N6OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S,3R)-3-[[2-(4-pyrrolidin-1-ylanilino)thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@H]1C2C=CC(C2)[C@H]1Nc1nc(Nc2ccc(N3CCCC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C24H26N6OS/c25-22(31)19-14-3-4-15(13-14)20(19)28-23-21-18(9-12-32-21)27-24(29-23)26-16-5-7-17(8-6-16)30-10-1-2-11-30/h3-9,12,14-15,19-20H,1-2,10-11,13H2,(H2,25,31)(H2,26,27,28,29)/t14?,15?,19-,20+/m0/s1 |
| InChIKey | GYURWNKDFFXENV-ZRLQOBAPSA-N |
| XLogP | 4.12 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|