C26H30N6O2S — CID 23585180
(2S,3R)-3-[[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 23585180) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is (2S,3R)-3-[[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (2S,3R)-3-[[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 23585180 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (2S,3R)-3-[[2-[4-(2-pyrrolidin-1-ylethoxy)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@H]1C2C=CC(C2)[C@H]1Nc1nc(Nc2ccc(OCCN3CCCC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C26H30N6O2S/c27-24(33)21-16-3-4-17(15-16)22(21)30-25-23-20(9-14-35-23)29-26(31-25)28-18-5-7-19(8-6-18)34-13-12-32-10-1-2-11-32/h3-9,14,16-17,21-22H,1-2,10-13,15H2,(H2,27,33)(H2,28,29,30,31)/t16?,17?,21-,22+/m0/s1 |
| InChIKey | XDQWTUXLYQBNLU-RIBBAFADSA-N |
| XLogP | 4.00 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|