C25H27ClN6O — CID 87458013
3-[[5-chloro-2-[(3-prop-2-ynyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 87458013) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is 3-[[5-chloro-2-[(3-prop-2-ynyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[5-chloro-2-[(3-prop-2-ynyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 87458013 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-[[5-chloro-2-[(3-prop-2-ynyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C#CCN1CCc2ccc(Nc3ncc(Cl)c(NC4C5C=CC(C5)C4C(N)=O)n3)cc2CC1 |
| InChI | InChI=1S/C25H27ClN6O/c1-2-9-32-10-7-15-5-6-19(13-16(15)8-11-32)29-25-28-14-20(26)24(31-25)30-22-18-4-3-17(12-18)21(22)23(27)33/h1,3-6,13-14,17-18,21-22H,7-12H2,(H2,27,33)(H2,28,29,30,31) |
| InChIKey | KDPFQCMMBHJWDH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|