C26H33ClN6O3 — CID 66830396
(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-[(2R)-2-hydroxypropyl]-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 66830396) has the molecular formula C26H33ClN6O3 and a molecular weight of 513.04 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-[(2R)-2-hydroxypropyl]-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-[(2R)-2-hydroxypropyl]-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 66830396 |
| Molecular Formula | C26H33ClN6O3 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-[(2R)-2-hydroxypropyl]-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(N[C@H]3[C@@H](C(N)=O)[C@@H]4C=C[C@H]3C4)n1)CCN(C[C@@H](C)O)CC2 |
| InChI | InChI=1S/C26H33ClN6O3/c1-14(34)13-33-7-5-15-10-20(21(36-2)11-16(15)6-8-33)30-26-29-12-19(27)25(32-26)31-23-18-4-3-17(9-18)22(23)24(28)35/h3-4,10-12,14,17-18,22-23,34H,5-9,13H2,1-2H3,(H2,28,35)(H2,29,30,31,32)/t14-,17-,18+,22+,23-/m1/s1 |
| InChIKey | GLPPCSVIARAAOR-MDKCPWPZSA-N |
| XLogP | 2.75 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|