C26H33ClN6O3 — CID 67264413
(1R,2R,3S,4S)-3-[[5-chloro-2-[[7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 67264413) has the molecular formula C26H33ClN6O3 and a molecular weight of 513.04 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[[5-chloro-2-[[7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,3S,4S)-3-[[5-chloro-2-[[7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 67264413 |
| Molecular Formula | C26H33ClN6O3 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (1R,2R,3S,4S)-3-[[5-chloro-2-[[7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COCCN1CCc2ccc(OC)c(Nc3ncc(Cl)c(N[C@@H]4[C@H](C(N)=O)[C@H]5C=C[C@@H]4C5)n3)c2CC1 |
| InChI | InChI=1S/C26H33ClN6O3/c1-35-12-11-33-9-7-15-5-6-20(36-2)23(18(15)8-10-33)31-26-29-14-19(27)25(32-26)30-22-17-4-3-16(13-17)21(22)24(28)34/h3-6,14,16-17,21-22H,7-13H2,1-2H3,(H2,28,34)(H2,29,30,31,32)/t16-,17+,21+,22-/m0/s1 |
| InChIKey | SNBVMFPEMUORRR-DVRVPYBTSA-N |
| XLogP | 3.02 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|