C26H31ClF2N6O2 — CID 67264534
(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(2,2-difluoropropyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 67264534) has the molecular formula C26H31ClF2N6O2 and a molecular weight of 533.02 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(2,2-difluoropropyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(2,2-difluoropropyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 67264534 |
| Molecular Formula | C26H31ClF2N6O2 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(2,2-difluoropropyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(N[C@H]3[C@@H](C(N)=O)[C@@H]4C=C[C@H]3C4)n1)CCN(CC(C)(F)F)CC2 |
| InChI | InChI=1S/C26H31ClF2N6O2/c1-26(28,29)13-35-7-5-14-10-19(20(37-2)11-15(14)6-8-35)32-25-31-12-18(27)24(34-25)33-22-17-4-3-16(9-17)21(22)23(30)36/h3-4,10-12,16-17,21-22H,5-9,13H2,1-2H3,(H2,30,36)(H2,31,32,33,34)/t16-,17+,21+,22-/m1/s1 |
| InChIKey | JPZFRNWDALVCRZ-XKPGHWPRSA-N |
| XLogP | 4.03 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|