C28H33ClN6O6 — CID 129111162
[(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(1,4-dioxane-2-carbonyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate (PubChem CID 129111162) has the molecular formula C28H33ClN6O6 and a molecular weight of 585.06 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(1,4-dioxane-2-carbonyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(1,4-dioxane-2-carbonyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
|---|---|
| PubChem CID | 129111162 |
| Molecular Formula | C28H33ClN6O6 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[3-(1,4-dioxane-2-carbonyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(N[C@H]3[C@@H](OC(N)=O)[C@@H]4C=C[C@H]3C4)n1)CCN(C(=O)C1COCCO1)CC2 |
| InChI | InChI=1S/C28H33ClN6O6/c1-38-21-12-16-5-7-35(26(36)22-14-39-8-9-40-22)6-4-15(16)11-20(21)32-28-31-13-19(29)25(34-28)33-23-17-2-3-18(10-17)24(23)41-27(30)37/h2-3,11-13,17-18,22-24H,4-10,14H2,1H3,(H2,30,37)(H2,31,32,33,34)/t17-,18+,22?,23+,24-/m0/s1 |
| InChIKey | WEIKXPFPGNKAQW-HSDOGTCKSA-N |
| XLogP | 2.68 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|