C26H31ClF2N6O3 — CID 118272705
[(1S,2S,3R,4R)-3-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate (PubChem CID 118272705) has the molecular formula C26H31ClF2N6O3 and a molecular weight of 549.02 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
|---|---|
| PubChem CID | 118272705 |
| Molecular Formula | C26H31ClF2N6O3 |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]amino]pyrimidin-4-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(N[C@H]3[C@@H](OC(N)=O)[C@@H]4C=C[C@H]3C4)n1)CCC(NCC(F)F)CC2 |
| InChI | InChI=1S/C26H31ClF2N6O3/c1-37-20-10-14-5-7-17(31-12-21(28)29)6-4-13(14)9-19(20)33-26-32-11-18(27)24(35-26)34-22-15-2-3-16(8-15)23(22)38-25(30)36/h2-3,9-11,15-17,21-23,31H,4-8,12H2,1H3,(H2,30,36)(H2,32,33,34,35)/t15-,16+,17?,22+,23-/m0/s1 |
| InChIKey | DNTLQUMOAXYDMK-ZJIVCAIISA-N |
| XLogP | 4.43 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|