C26H31ClF2N6O3S — CID 25158760
2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl]amino]pyrimidin-4-yl]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 25158760) has the molecular formula C26H31ClF2N6O3S and a molecular weight of 581.09 g/mol. Its IUPAC name is 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl]amino]pyrimidin-4-yl]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl]amino]pyrimidin-4-yl]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25158760 |
| Molecular Formula | C26H31ClF2N6O3S |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl]amino]pyrimidin-4-yl]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1Nc1ncc(Cl)c(Nc3ccccc3S(=O)(=O)N(C)C)n1)CCC(NCC(F)F)CC2 |
| InChI | InChI=1S/C26H31ClF2N6O3S/c1-35(2)39(36,37)22-7-5-4-6-20(22)32-25-19(27)14-31-26(34-25)33-24-18-12-11-17(30-15-23(28)29)10-8-16(18)9-13-21(24)38-3/h4-7,9,13-14,17,23,30H,8,10-12,15H2,1-3H3,(H2,31,32,33,34) |
| InChIKey | DELBXRZJQHMTKU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |