C26H30N10O2S — CID 118563463
(2S,3R)-3-[[2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N-hydrazinylidenebicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 118563463) has the molecular formula C26H30N10O2S and a molecular weight of 546.66 g/mol. Its IUPAC name is (2S,3R)-3-[[2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N-hydrazinylidenebicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (2S,3R)-3-[[2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N-hydrazinylidenebicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 118563463 |
| Molecular Formula | C26H30N10O2S |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | (2S,3R)-3-[[2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N-hydrazinylidenebicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N/N=N/C(=O)[C@H]1C2C=CC(C2)[C@H]1Nc1nc(Nc2ccc(N3CCN(CC(N)=O)CC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C26H30N10O2S/c27-20(37)14-35-8-10-36(11-9-35)18-5-3-17(4-6-18)29-26-30-19-7-12-39-23(19)24(32-26)31-22-16-2-1-15(13-16)21(22)25(38)33-34-28/h1-7,12,15-16,21-22H,8-11,13-14H2,(H2,27,37)(H2,28,33,38)(H2,29,30,31,32)/t15?,16?,21-,22+/m0/s1 |
| InChIKey | ZFVFXLZYMLSMAA-MMQSDSLKSA-N |
| XLogP | 2.50 |
| TPSA | 167.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|