C27H31N5O3S2 — CID 139305705
1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol (PubChem CID 139305705) has the molecular formula C27H31N5O3S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol.
| Compound Name | 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 139305705 |
| Molecular Formula | C27H31N5O3S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
| SMILES | CC(C)S(=O)(=O)c1ccccc1CNc1nc(Nc2ccc(N3CCC(O)CC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C27H31N5O3S2/c1-18(2)37(34,35)24-6-4-3-5-19(24)17-28-26-25-23(13-16-36-25)30-27(31-26)29-20-7-9-21(10-8-20)32-14-11-22(33)12-15-32/h3-10,13,16,18,22,33H,11-12,14-15,17H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | ZCNXLFIQRSKZOC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|