C27H30N4O3S2 — CID 158280904
4-[4-(2,2-dimethylpropylsulfonyl)phenyl]-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 158280904) has the molecular formula C27H30N4O3S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylpropylsulfonyl)phenyl]-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[4-(2,2-dimethylpropylsulfonyl)phenyl]-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 158280904 |
| Molecular Formula | C27H30N4O3S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 4-[4-(2,2-dimethylpropylsulfonyl)phenyl]-N-(4-morpholin-4-ylphenyl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CC(C)(C)CS(=O)(=O)c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)nc3ccsc23)cc1 |
| InChI | InChI=1S/C27H30N4O3S2/c1-27(2,3)18-36(32,33)22-10-4-19(5-11-22)24-25-23(12-17-35-25)29-26(30-24)28-20-6-8-21(9-7-20)31-13-15-34-16-14-31/h4-12,17H,13-16,18H2,1-3H3,(H,28,29,30) |
| InChIKey | FKRBXFKNQFEKCG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|