C24H24N8OS — CID 90296652
2-[3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 90296652) has the molecular formula C24H24N8OS and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-[3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 90296652 |
| Molecular Formula | C24H24N8OS |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | N#CCC1(n2cc(-c3nc(Nc4ccc(N5CCOCC5)cc4)nc4ccsc34)cn2)CNC1 |
| InChI | InChI=1S/C24H24N8OS/c25-7-6-24(15-26-16-24)32-14-17(13-27-32)21-22-20(5-12-34-22)29-23(30-21)28-18-1-3-19(4-2-18)31-8-10-33-11-9-31/h1-5,12-14,26H,6,8-11,15-16H2,(H,28,29,30) |
| InChIKey | SAINEVANKRDGPQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|