C23H23N7O2S3 — CID 144669223
2-[1-ethylsulfanyl-3-[4-[2-(4-methylsulfonylanilino)thieno[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 144669223) has the molecular formula C23H23N7O2S3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 2-[1-ethylsulfanyl-3-[4-[2-(4-methylsulfonylanilino)thieno[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-ethylsulfanyl-3-[4-[2-(4-methylsulfonylanilino)thieno[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 144669223 |
| Molecular Formula | C23H23N7O2S3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 2-[1-ethylsulfanyl-3-[4-[2-(4-methylsulfonylanilino)thieno[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CCSN1CC(CC#N)(n2cc(-c3nc(Nc4ccc(S(C)(=O)=O)cc4)nc4sccc34)cn2)C1 |
| InChI | InChI=1S/C23H23N7O2S3/c1-3-34-29-14-23(15-29,9-10-24)30-13-16(12-25-30)20-19-8-11-33-21(19)28-22(27-20)26-17-4-6-18(7-5-17)35(2,31)32/h4-8,11-13H,3,9,14-15H2,1-2H3,(H,26,27,28) |
| InChIKey | KOQFOOKDFNIRPE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|