C23H25N7O — CID 174581810
6-[4-(dimethylamino)phenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine (PubChem CID 174581810) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine.
| Compound Name | 6-[4-(dimethylamino)phenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 174581810 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine |
| SMILES | CN(C)c1ccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C23H25N7O/c1-29(2)18-7-3-16(4-8-18)20-21-22(25-15-24-21)28-23(27-20)26-17-5-9-19(10-6-17)30-11-13-31-14-12-30/h3-10,15H,11-14H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | JAJFTKICZSAFAS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|