C22H22ClN7O — CID 174597306
6-[5-(aminomethyl)-2-chlorophenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine (PubChem CID 174597306) has the molecular formula C22H22ClN7O and a molecular weight of 435.92 g/mol. Its IUPAC name is 6-[5-(aminomethyl)-2-chlorophenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine.
| Compound Name | 6-[5-(aminomethyl)-2-chlorophenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 174597306 |
| Molecular Formula | C22H22ClN7O |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 6-[5-(aminomethyl)-2-chlorophenyl]-N-(4-morpholin-4-ylphenyl)-7H-purin-2-amine |
| SMILES | NCc1ccc(Cl)c(-c2nc(Nc3ccc(N4CCOCC4)cc3)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C22H22ClN7O/c23-18-6-1-14(12-24)11-17(18)19-20-21(26-13-25-20)29-22(28-19)27-15-2-4-16(5-3-15)30-7-9-31-10-8-30/h1-6,11,13H,7-10,12,24H2,(H2,25,26,27,28,29) |
| InChIKey | YCOSTYVKQDKUBY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|