C21H22ClN5O2 — CID 155565534
4-chloro-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenol (PubChem CID 155565534) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-chloro-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-chloro-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 155565534 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-chloro-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenol |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1cc(O)ccc1Cl |
| InChI | InChI=1S/C21H22ClN5O2/c1-14-13-23-21(26-20(14)25-19-12-17(28)6-7-18(19)22)24-15-2-4-16(5-3-15)27-8-10-29-11-9-27/h2-7,12-13,28H,8-11H2,1H3,(H2,23,24,25,26) |
| InChIKey | WTLUSEIPWFKERY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|