C20H22N6O3S — CID 168866708
N-hydroxy-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxamide (PubChem CID 168866708) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is N-hydroxy-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxamide.
| Compound Name | N-hydroxy-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 168866708 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-hydroxy-3-[[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1ccsc1C(=O)NO |
| InChI | InChI=1S/C20H22N6O3S/c1-13-12-21-20(24-18(13)23-16-6-11-30-17(16)19(27)25-28)22-14-2-4-15(5-3-14)26-7-9-29-10-8-26/h2-6,11-12,28H,7-10H2,1H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | MPDCDKSKBWZNQH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|