C19H18ClN5O3S — CID 175696484
3-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylic acid (PubChem CID 175696484) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is 3-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 175696484 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1Cl |
| InChI | InChI=1S/C19H18ClN5O3S/c20-14-11-21-19(24-17(14)23-15-5-10-29-16(15)18(26)27)22-12-1-3-13(4-2-12)25-6-8-28-9-7-25/h1-5,10-11H,6-9H2,(H,26,27)(H2,21,22,23,24) |
| InChIKey | UPJNPSZTTUVQKZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|