C26H31ClN6O — CID 131729555
5-chloro-2-N-(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-4-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 131729555) has the molecular formula C26H31ClN6O and a molecular weight of 479.03 g/mol. Its IUPAC name is 5-chloro-2-N-(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-4-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-4-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 131729555 |
| Molecular Formula | C26H31ClN6O |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 5-chloro-2-N-(3-ethyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-4-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCN1CCc2ccc(Nc3ncc(Cl)c(Nc4ccc(N5CCOCC5)cc4)n3)cc2CC1 |
| InChI | InChI=1S/C26H31ClN6O/c1-2-32-11-9-19-3-4-22(17-20(19)10-12-32)30-26-28-18-24(27)25(31-26)29-21-5-7-23(8-6-21)33-13-15-34-16-14-33/h3-8,17-18H,2,9-16H2,1H3,(H2,28,29,30,31) |
| InChIKey | SNZLMVRXVZXIBR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|