C22H24BrFN6 — CID 142899054
5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-(4-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 142899054) has the molecular formula C22H24BrFN6 and a molecular weight of 471.38 g/mol. Its IUPAC name is 5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-(4-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-(4-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142899054 |
| Molecular Formula | C22H24BrFN6 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-(4-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(Br)c(Nc4ccc(F)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H24BrFN6/c1-2-29-11-13-30(14-12-29)19-9-7-18(8-10-19)27-22-25-15-20(23)21(28-22)26-17-5-3-16(24)4-6-17/h3-10,15H,2,11-14H2,1H3,(H2,25,26,27,28) |
| InChIKey | JPGXZAHCKNPZSF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|