C20H28N6 — CID 112888331
4-(4-ethylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 112888331) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112888331 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccnc(Nc3ccc(N4CCCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C20H28N6/c1-2-24-13-15-26(16-14-24)19-9-10-21-20(23-19)22-17-5-7-18(8-6-17)25-11-3-4-12-25/h5-10H,2-4,11-16H2,1H3,(H,21,22,23) |
| InChIKey | NVONUMPXRDBZFU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|