C20H27N7O — CID 112888637
4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 112888637) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112888637 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | CN1CCN(c2ccc(Nc3nccc(N4CCN(C=O)CC4)n3)cc2)CC1 |
| InChI | InChI=1S/C20H27N7O/c1-24-8-12-26(13-9-24)18-4-2-17(3-5-18)22-20-21-7-6-19(23-20)27-14-10-25(16-28)11-15-27/h2-7,16H,8-15H2,1H3,(H,21,22,23) |
| InChIKey | DEAIQJOZJBBYRW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|