C30H42N10O — CID 174974532
4-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazin-1-yl]benzamide;piperazine (PubChem CID 174974532) has the molecular formula C30H42N10O and a molecular weight of 558.74 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazin-1-yl]benzamide;piperazine.
| Compound Name | 4-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazin-1-yl]benzamide;piperazine |
|---|---|
| PubChem CID | 174974532 |
| Molecular Formula | C30H42N10O |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 4-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]piperazin-1-yl]benzamide;piperazine |
| SMILES | C1CNCCN1.CN1CCN(c2ccc(Nc3nccc(N4CCN(c5ccc(C(N)=O)cc5)CC4)n3)cc2)CC1 |
| InChI | InChI=1S/C26H32N8O.C4H10N2/c1-31-12-14-32(15-13-31)23-8-4-21(5-9-23)29-26-28-11-10-24(30-26)34-18-16-33(17-19-34)22-6-2-20(3-7-22)25(27)35;1-2-6-4-3-5-1/h2-11H,12-19H2,1H3,(H2,27,35)(H,28,29,30);5-6H,1-4H2 |
| InChIKey | OCMIXXZVCCORLT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|