C17H24N5OP — CID 142786206
N-(4-dimethylphosphorylphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 142786206) has the molecular formula C17H24N5OP and a molecular weight of 345.39 g/mol. Its IUPAC name is N-(4-dimethylphosphorylphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(4-dimethylphosphorylphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 142786206 |
| Molecular Formula | C17H24N5OP |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(4-dimethylphosphorylphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccnc(Nc3ccc(P(C)(C)=O)cc3)n2)CC1 |
| InChI | InChI=1S/C17H24N5OP/c1-21-10-12-22(13-11-21)16-8-9-18-17(20-16)19-14-4-6-15(7-5-14)24(2,3)23/h4-9H,10-13H2,1-3H3,(H,18,19,20) |
| InChIKey | FUNZDKMUNJOORI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|