C16H23N7 — CID 66669998
2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 66669998) has the molecular formula C16H23N7 and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66669998 |
| Molecular Formula | C16H23N7 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc(NC)n3)cc2)CC1 |
| InChI | InChI=1S/C16H23N7/c1-3-22-8-10-23(11-9-22)14-6-4-13(5-7-14)20-16-19-12-18-15(17-2)21-16/h4-7,12H,3,8-11H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | VXWKZSGLOUDJIL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|