C27H35N7O — CID 91342361
(2S)-2-[4-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]anilino]-3-methylbutanamide (PubChem CID 91342361) has the molecular formula C27H35N7O and a molecular weight of 473.63 g/mol. Its IUPAC name is (2S)-2-[4-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]anilino]-3-methylbutanamide.
| Compound Name | (2S)-2-[4-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]anilino]-3-methylbutanamide |
|---|---|
| PubChem CID | 91342361 |
| Molecular Formula | C27H35N7O |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | (2S)-2-[4-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]anilino]-3-methylbutanamide |
| SMILES | CCN1CCN(c2ccc(Nc3nccc(-c4ccc(N[C@H](C(N)=O)C(C)C)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H35N7O/c1-4-33-15-17-34(18-16-33)23-11-9-22(10-12-23)31-27-29-14-13-24(32-27)20-5-7-21(8-6-20)30-25(19(2)3)26(28)35/h5-14,19,25,30H,4,15-18H2,1-3H3,(H2,28,35)(H,29,31,32)/t25-/m0/s1 |
| InChIKey | BKZDSGRGFSMZKK-VWLOTQADSA-N |
| XLogP | 3.95 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|