C24H27N7O3 — CID 69021858
(2R)-2-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]anilino]butanediamide (PubChem CID 69021858) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is (2R)-2-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]anilino]butanediamide.
| Compound Name | (2R)-2-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]anilino]butanediamide |
|---|---|
| PubChem CID | 69021858 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (2R)-2-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]anilino]butanediamide |
| SMILES | NC(=O)C[C@@H](Nc1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1)C(N)=O |
| InChI | InChI=1S/C24H27N7O3/c25-22(32)15-21(23(26)33)28-17-3-1-16(2-4-17)20-9-10-27-24(30-20)29-18-5-7-19(8-6-18)31-11-13-34-14-12-31/h1-10,21,28H,11-15H2,(H2,25,32)(H2,26,33)(H,27,29,30)/t21-/m1/s1 |
| InChIKey | IBPSBFNONSNOTI-OAQYLSRUSA-N |
| XLogP | 1.87 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|