C28H35N6O2+ — CID 87660712
(2R)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-1-propan-2-ylpyrrolidin-1-ium-2-carboxamide (PubChem CID 87660712) has the molecular formula C28H35N6O2+ and a molecular weight of 487.63 g/mol. Its IUPAC name is (2R)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-1-propan-2-ylpyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2R)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-1-propan-2-ylpyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87660712 |
| Molecular Formula | C28H35N6O2+ |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (2R)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-1-propan-2-ylpyrrolidin-1-ium-2-carboxamide |
| SMILES | CC(C)[N+]1(c2ccc(-c3ccnc(Nc4ccc(N5CCOCC5)cc4)n3)cc2)CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C28H34N6O2/c1-20(2)34(17-3-4-26(34)27(29)35)24-11-5-21(6-12-24)25-13-14-30-28(32-25)31-22-7-9-23(10-8-22)33-15-18-36-19-16-33/h5-14,20,26H,3-4,15-19H2,1-2H3,(H2-,29,30,31,32,35)/p+1/t26-,34?/m1/s1 |
| InChIKey | QOOFIIBPCBZTKU-URAFEBPUSA-O |
| XLogP | 4.09 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|