C30H37N6O4+ — CID 87724908
(2R)-1-tert-butyl-2-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]carbamoyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 87724908) has the molecular formula C30H37N6O4+ and a molecular weight of 545.66 g/mol. Its IUPAC name is (2R)-1-tert-butyl-2-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]carbamoyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-tert-butyl-2-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]carbamoyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 87724908 |
| Molecular Formula | C30H37N6O4+ |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (2R)-1-tert-butyl-2-[[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]carbamoyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)CCC[C@@H]1C(=O)Nc1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C30H36N6O4/c1-30(2,3)36(29(38)39)18-4-5-26(36)27(37)32-22-8-6-21(7-9-22)25-14-15-31-28(34-25)33-23-10-12-24(13-11-23)35-16-19-40-20-17-35/h6-15,26H,4-5,16-20H2,1-3H3,(H2-,31,32,33,34,37,38,39)/p+1/t26-,36?/m1/s1 |
| InChIKey | MHDZGMWEEYTEDA-IERCKHOLSA-O |
| XLogP | 5.12 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|