C25H29N7O — CID 70315153
(2R)-N-[4-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 70315153) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is (2R)-N-[4-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70315153 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (2R)-N-[4-[2-(4-piperazin-1-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccnc(Nc3ccc(N4CCNCC4)cc3)n2)cc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C25H29N7O/c33-24(23-2-1-12-27-23)29-19-5-3-18(4-6-19)22-11-13-28-25(31-22)30-20-7-9-21(10-8-20)32-16-14-26-15-17-32/h3-11,13,23,26-27H,1-2,12,14-17H2,(H,29,33)(H,28,30,31)/t23-/m1/s1 |
| InChIKey | DWGWZZYHPCINPF-HSZRJFAPSA-N |
| XLogP | 2.99 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|