C28H33N7O3 — CID 90966040
(2S)-N-[4-[2-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 90966040) has the molecular formula C28H33N7O3 and a molecular weight of 515.62 g/mol. Its IUPAC name is (2S)-N-[4-[2-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[2-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90966040 |
| Molecular Formula | C28H33N7O3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | (2S)-N-[4-[2-[4-[4-(3-hydroxypropanoyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccnc(Nc3ccc(N4CCN(C(=O)CCO)CC4)cc3)n2)cc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C28H33N7O3/c36-19-12-26(37)35-17-15-34(16-18-35)23-9-7-22(8-10-23)32-28-30-14-11-24(33-28)20-3-5-21(6-4-20)31-27(38)25-2-1-13-29-25/h3-11,14,25,29,36H,1-2,12-13,15-19H2,(H,31,38)(H,30,32,33)/t25-/m0/s1 |
| InChIKey | BCDGUEBIKPVOJO-VWLOTQADSA-N |
| XLogP | 2.61 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|