C25H27ClN6O2 — CID 69024259
N-[4-[2-(3-chloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 69024259) has the molecular formula C25H27ClN6O2 and a molecular weight of 478.98 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[4-[2-(3-chloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69024259 |
| Molecular Formula | C25H27ClN6O2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[4-[2-(3-chloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)c(Cl)c3)n2)cc1)C1CCCN1 |
| InChI | InChI=1S/C25H27ClN6O2/c26-20-16-19(7-8-23(20)32-12-14-34-15-13-32)30-25-28-11-9-21(31-25)17-3-5-18(6-4-17)29-24(33)22-2-1-10-27-22/h3-9,11,16,22,27H,1-2,10,12-15H2,(H,29,33)(H,28,30,31) |
| InChIKey | LQRCFIQTXSEXMB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|