C20H22ClN5O — CID 24762454
N-(3-chloro-4-morpholin-4-ylphenyl)-4-(2,4-dimethyl-1H-pyrrol-3-yl)pyrimidin-2-amine (PubChem CID 24762454) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-4-(2,4-dimethyl-1H-pyrrol-3-yl)pyrimidin-2-amine.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-4-(2,4-dimethyl-1H-pyrrol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 24762454 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-4-(2,4-dimethyl-1H-pyrrol-3-yl)pyrimidin-2-amine |
| SMILES | Cc1c[nH]c(C)c1-c1ccnc(Nc2ccc(N3CCOCC3)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H22ClN5O/c1-13-12-23-14(2)19(13)17-5-6-22-20(25-17)24-15-3-4-18(16(21)11-15)26-7-9-27-10-8-26/h3-6,11-12,23H,7-10H2,1-2H3,(H,22,24,25) |
| InChIKey | ULKIFYGOYZNRQS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|