C23H25Cl2N5O3 — CID 24762528
ethyl 4-[2-(3,5-dichloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 24762528) has the molecular formula C23H25Cl2N5O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is ethyl 4-[2-(3,5-dichloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-(3,5-dichloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 24762528 |
| Molecular Formula | C23H25Cl2N5O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | ethyl 4-[2-(3,5-dichloro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(-c2ccnc(Nc3cc(Cl)c(N4CCOCC4)c(Cl)c3)n2)c1C |
| InChI | InChI=1S/C23H25Cl2N5O3/c1-4-33-22(31)20-13(2)19(14(3)27-20)18-5-6-26-23(29-18)28-15-11-16(24)21(17(25)12-15)30-7-9-32-10-8-30/h5-6,11-12,27H,4,7-10H2,1-3H3,(H,26,28,29) |
| InChIKey | MNDMZRZTDDIEPY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|