C28H32N4O3 — CID 141304810
N-(3-cyclopropyl-4-morpholin-4-ylphenyl)-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine (PubChem CID 141304810) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(3-cyclopropyl-4-morpholin-4-ylphenyl)-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine.
| Compound Name | N-(3-cyclopropyl-4-morpholin-4-ylphenyl)-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141304810 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-(3-cyclopropyl-4-morpholin-4-ylphenyl)-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
| SMILES | c1cc(-c2ccc(OC3CCOCC3)cc2)nc(Nc2ccc(N3CCOCC3)c(C3CC3)c2)n1 |
| InChI | InChI=1S/C28H32N4O3/c1-2-20(1)25-19-22(5-8-27(25)32-13-17-34-18-14-32)30-28-29-12-9-26(31-28)21-3-6-23(7-4-21)35-24-10-15-33-16-11-24/h3-9,12,19-20,24H,1-2,10-11,13-18H2,(H,29,30,31) |
| InChIKey | ZGAXQXXYHZRXAF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|