C25H25N5O2 — CID 141304812
N-[4-(imidazol-1-ylmethyl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine (PubChem CID 141304812) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[4-(imidazol-1-ylmethyl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine.
| Compound Name | N-[4-(imidazol-1-ylmethyl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141304812 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[4-(imidazol-1-ylmethyl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
| SMILES | c1cn(Cc2ccc(Nc3nccc(-c4ccc(OC5CCOCC5)cc4)n3)cc2)cn1 |
| InChI | InChI=1S/C25H25N5O2/c1-5-21(6-2-19(1)17-30-14-13-26-18-30)28-25-27-12-9-24(29-25)20-3-7-22(8-4-20)32-23-10-15-31-16-11-23/h1-9,12-14,18,23H,10-11,15-17H2,(H,27,28,29) |
| InChIKey | VJMHVYLHXSWFDH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |