C26H31N5O4S — CID 141304825
N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine (PubChem CID 141304825) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141304825 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-4-[4-(oxan-4-yloxy)phenyl]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(Nc3nccc(-c4ccc(OC5CCOCC5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C26H31N5O4S/c1-36(32,33)31-16-14-30(15-17-31)22-6-4-21(5-7-22)28-26-27-13-10-25(29-26)20-2-8-23(9-3-20)35-24-11-18-34-19-12-24/h2-10,13,24H,11-12,14-19H2,1H3,(H,27,28,29) |
| InChIKey | BDIIKQWXCKFSCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|