C28H30N6O3 — CID 138561764
5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]-2-(oxolan-3-yloxy)benzonitrile (PubChem CID 138561764) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]-2-(oxolan-3-yloxy)benzonitrile.
| Compound Name | 5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]-2-(oxolan-3-yloxy)benzonitrile |
|---|---|
| PubChem CID | 138561764 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]-2-(oxolan-3-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OC1CCOC1 |
| InChI | InChI=1S/C28H30N6O3/c29-16-21-15-20(1-6-27(21)37-25-8-14-35-19-25)26-7-9-30-28(32-26)31-22-2-4-23(5-3-22)33-10-12-34(13-11-33)24-17-36-18-24/h1-7,9,15,24-25H,8,10-14,17-19H2,(H,30,31,32) |
| InChIKey | XSSCNENIVUUBEN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|