C27H28N6O4 — CID 51357283
2-[1-(3-hydroxypropanoyl)azetidin-3-yl]oxy-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile (PubChem CID 51357283) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is 2-[1-(3-hydroxypropanoyl)azetidin-3-yl]oxy-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-[1-(3-hydroxypropanoyl)azetidin-3-yl]oxy-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 51357283 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[1-(3-hydroxypropanoyl)azetidin-3-yl]oxy-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)ccc1OC1CN(C(=O)CCO)C1 |
| InChI | InChI=1S/C27H28N6O4/c28-16-20-15-19(1-6-25(20)37-23-17-33(18-23)26(35)8-12-34)24-7-9-29-27(31-24)30-21-2-4-22(5-3-21)32-10-13-36-14-11-32/h1-7,9,15,23,34H,8,10-14,17-18H2,(H,29,30,31) |
| InChIKey | XDLOXQCVPSOTDT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|