C27H30N6O2 — CID 67114773
2-(cyclopropylmethoxy)-5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]benzonitrile (PubChem CID 67114773) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(cyclopropylmethoxy)-5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 67114773 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-(cyclopropylmethoxy)-5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCN(CCO)CC4)cc3)n2)ccc1OCC1CC1 |
| InChI | InChI=1S/C27H30N6O2/c28-18-22-17-21(3-8-26(22)35-19-20-1-2-20)25-9-10-29-27(31-25)30-23-4-6-24(7-5-23)33-13-11-32(12-14-33)15-16-34/h3-10,17,20,34H,1-2,11-16,19H2,(H,29,30,31) |
| InChIKey | LGOCEQKGULDJAT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|