C28H31N7O3 — CID 51357563
N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-4-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 51357563) has the molecular formula C28H31N7O3 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-4-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-4-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51357563 |
| Molecular Formula | C28H31N7O3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-4-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)ccc1NC(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C28H31N7O3/c29-18-22-17-21(1-6-25(22)33-28(37)35-11-8-20(19-36)9-12-35)26-7-10-30-27(32-26)31-23-2-4-24(5-3-23)34-13-15-38-16-14-34/h1-7,10,17,20,36H,8-9,11-16,19H2,(H,33,37)(H,30,31,32) |
| InChIKey | UMFHWQIYHGPPOI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|