C27H28N6O3 — CID 149142313
N-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]morpholine-4-carboxamide (PubChem CID 149142313) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 149142313 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | N-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]morpholine-4-carboxamide |
| SMILES | N#Cc1cc(-c2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)ccc1NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H28N6O3/c28-19-22-18-21(3-6-24(22)31-27(34)33-11-15-36-16-12-33)25-7-8-29-26(30-25)17-20-1-4-23(5-2-20)32-9-13-35-14-10-32/h1-8,18H,9-17H2,(H,31,34) |
| InChIKey | RIGXWDBFRMCLLJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|