C28H30N4OS — CID 159444199
2-cyclohexylsulfanyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile (PubChem CID 159444199) has the molecular formula C28H30N4OS and a molecular weight of 470.64 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-cyclohexylsulfanyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 159444199 |
| Molecular Formula | C28H30N4OS |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-cyclohexylsulfanyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)ccc1SC1CCCCC1 |
| InChI | InChI=1S/C28H30N4OS/c29-20-23-19-22(8-11-27(23)34-25-4-2-1-3-5-25)26-12-13-30-28(31-26)18-21-6-9-24(10-7-21)32-14-16-33-17-15-32/h6-13,19,25H,1-5,14-18H2 |
| InChIKey | LSOGFMSWJPPQBP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|