C25H24N4O2 — CID 157074303
4-[4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-3-oxobutanenitrile (PubChem CID 157074303) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-3-oxobutanenitrile.
| Compound Name | 4-[4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 157074303 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-[4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-3-oxobutanenitrile |
| SMILES | N#CCC(=O)Cc1ccc(-c2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H24N4O2/c26-11-9-23(30)17-19-1-5-21(6-2-19)24-10-12-27-25(28-24)18-20-3-7-22(8-4-20)29-13-15-31-16-14-29/h1-8,10,12H,9,13-18H2 |
| InChIKey | ACUGNTVSGMCLDF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|