C25H26N6O2 — CID 159191974
3-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-1,1-dimethylurea (PubChem CID 159191974) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 159191974 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-[2-cyano-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(-c2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)cc1C#N |
| InChI | InChI=1S/C25H26N6O2/c1-30(2)25(32)29-22-8-5-19(16-20(22)17-26)23-9-10-27-24(28-23)15-18-3-6-21(7-4-18)31-11-13-33-14-12-31/h3-10,16H,11-15H2,1-2H3,(H,29,32) |
| InChIKey | KOEUARGVBWPQHB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|