C29H33N5O3 — CID 162226109
N-[2-cyano-4-[2-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 162226109) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[2-cyano-4-[2-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-cyano-4-[2-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162226109 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[2-cyano-4-[2-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(-c2ccnc(Cc3ccc(OCCCN4CCOCC4)cc3)n2)cc1C#N |
| InChI | InChI=1S/C29H33N5O3/c1-21(2)29(35)33-26-9-6-23(19-24(26)20-30)27-10-11-31-28(32-27)18-22-4-7-25(8-5-22)37-15-3-12-34-13-16-36-17-14-34/h4-11,19,21H,3,12-18H2,1-2H3,(H,33,35) |
| InChIKey | ZUUBEINEBQMSQZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|