C24H20F4N6O2 — CID 88898270
N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 88898270) has the molecular formula C24H20F4N6O2 and a molecular weight of 500.46 g/mol. Its IUPAC name is N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 88898270 |
| Molecular Formula | C24H20F4N6O2 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[2-cyano-4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)ccc1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C24H20F4N6O2/c25-21(26)24(27,28)22(35)32-19-6-1-15(13-16(19)14-29)20-7-8-30-23(33-20)31-17-2-4-18(5-3-17)34-9-11-36-12-10-34/h1-8,13,21H,9-12H2,(H,32,35)(H,30,31,33) |
| InChIKey | VELUYJJGSLOGPD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|