C25H27N5O3 — CID 67115632
2-(2-hydroxy-2-methylpropoxy)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile (PubChem CID 67115632) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-(2-hydroxy-2-methylpropoxy)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(2-hydroxy-2-methylpropoxy)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 67115632 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-(2-hydroxy-2-methylpropoxy)-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]benzonitrile |
| SMILES | CC(C)(O)COc1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1C#N |
| InChI | InChI=1S/C25H27N5O3/c1-25(2,31)17-33-23-8-3-18(15-19(23)16-26)22-9-10-27-24(29-22)28-20-4-6-21(7-5-20)30-11-13-32-14-12-30/h3-10,15,31H,11-14,17H2,1-2H3,(H,27,28,29) |
| InChIKey | WESICWARAPSFFU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|