C22H19ClN4O — CID 146915900
3-chloro-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile (PubChem CID 146915900) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is 3-chloro-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 3-chloro-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 146915900 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-chloro-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(Cl)cc(-c2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C22H19ClN4O/c23-19-12-17(15-24)11-18(14-19)21-5-6-25-22(26-21)13-16-1-3-20(4-2-16)27-7-9-28-10-8-27/h1-6,11-12,14H,7-10,13H2 |
| InChIKey | ACFHMRLJLCBFJZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|